C28H34FN3O6S — CID 86713243
methyl (3aR,9bR)-5-acetyl-7-[[2-[(Z)-3-(diethylamino)prop-1-enyl]-4-fluorophenyl]sulfonylamino]-2,3a,4,9b-tetrahydro-1H-furo[2,3-c]quinoline-6-carboxylate (PubChem CID 86713243) has the molecular formula C28H34FN3O6S and a molecular weight of 559.66 g/mol. Its IUPAC name is methyl (3aR,9bR)-5-acetyl-7-[[2-[(Z)-3-(diethylamino)prop-1-enyl]-4-fluorophenyl]sulfonylamino]-2,3a,4,9b-tetrahydro-1H-furo[2,3-c]quinoline-6-carboxylate.
| Compound Name | methyl (3aR,9bR)-5-acetyl-7-[[2-[(Z)-3-(diethylamino)prop-1-enyl]-4-fluorophenyl]sulfonylamino]-2,3a,4,9b-tetrahydro-1H-furo[2,3-c]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 86713243 |
| Molecular Formula | C28H34FN3O6S |
| Molecular Weight | 559.66 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | methyl (3aR,9bR)-5-acetyl-7-[[2-[(Z)-3-(diethylamino)prop-1-enyl]-4-fluorophenyl]sulfonylamino]-2,3a,4,9b-tetrahydro-1H-furo[2,3-c]quinoline-6-carboxylate |
| SMILES | CCN(CC)C/C=C\c1cc(F)ccc1S(=O)(=O)Nc1ccc2c(c1C(=O)OC)N(C(C)=O)C[C@@H]1OCC[C@H]21 |
| InChI | InChI=1S/C28H34FN3O6S/c1-5-31(6-2)14-7-8-19-16-20(29)9-12-25(19)39(35,36)30-23-11-10-22-21-13-15-38-24(21)17-32(18(3)33)27(22)26(23)28(34)37-4/h7-12,16,21,24,30H,5-6,13-15,17H2,1-4H3/b8-7-/t21-,24+/m1/s1 |
| InChIKey | OMLLVHRTQPAKCG-AMFOIEFKSA-N |
| XLogP | 4.01 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.66 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |