C26H31FN2O6S — CID 89182889
methyl (3aS,9bS)-7-[[2-[(Z)-3-(diethylamino)prop-1-enyl]-4-fluorophenyl]sulfonylamino]-2,3a,4,9b-tetrahydro-1H-furo[2,3-c]chromene-6-carboxylate (PubChem CID 89182889) has the molecular formula C26H31FN2O6S and a molecular weight of 518.61 g/mol. Its IUPAC name is methyl (3aS,9bS)-7-[[2-[(Z)-3-(diethylamino)prop-1-enyl]-4-fluorophenyl]sulfonylamino]-2,3a,4,9b-tetrahydro-1H-furo[2,3-c]chromene-6-carboxylate.
| Compound Name | methyl (3aS,9bS)-7-[[2-[(Z)-3-(diethylamino)prop-1-enyl]-4-fluorophenyl]sulfonylamino]-2,3a,4,9b-tetrahydro-1H-furo[2,3-c]chromene-6-carboxylate |
|---|---|
| PubChem CID | 89182889 |
| Molecular Formula | C26H31FN2O6S |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | methyl (3aS,9bS)-7-[[2-[(Z)-3-(diethylamino)prop-1-enyl]-4-fluorophenyl]sulfonylamino]-2,3a,4,9b-tetrahydro-1H-furo[2,3-c]chromene-6-carboxylate |
| SMILES | CCN(CC)C/C=C\c1cc(F)ccc1S(=O)(=O)Nc1ccc2c(c1C(=O)OC)OC[C@H]1OCC[C@@H]21 |
| InChI | InChI=1S/C26H31FN2O6S/c1-4-29(5-2)13-6-7-17-15-18(27)8-11-23(17)36(31,32)28-21-10-9-20-19-12-14-34-22(19)16-35-25(20)24(21)26(30)33-3/h6-11,15,19,22,28H,4-5,12-14,16H2,1-3H3/b7-6-/t19-,22+/m0/s1 |
| InChIKey | CMHAJRYOHCJKDE-JNKZXAJXSA-N |
| XLogP | 4.03 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |