C12H17ClFN3OS — CID 86714751
S-[(2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] ethanethioate (PubChem CID 86714751) has the molecular formula C12H17ClFN3OS and a molecular weight of 305.81 g/mol. Its IUPAC name is S-[(2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] ethanethioate.
| Compound Name | S-[(2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] ethanethioate |
|---|---|
| PubChem CID | 86714751 |
| Molecular Formula | C12H17ClFN3OS |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | S-[(2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] ethanethioate |
| SMILES | CC(=O)SC[C@@H](Nc1nc(Cl)ncc1F)C(C)(C)C |
| InChI | InChI=1S/C12H17ClFN3OS/c1-7(18)19-6-9(12(2,3)4)16-10-8(14)5-15-11(13)17-10/h5,9H,6H2,1-4H3,(H,15,16,17)/t9-/m1/s1 |
| InChIKey | RMPGWJSJCMHPKS-SECBINFHSA-N |
| XLogP | 3.38 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|