C11H17ClFN3O3S — CID 86714750
[(2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] methanesulfonate (PubChem CID 86714750) has the molecular formula C11H17ClFN3O3S and a molecular weight of 325.79 g/mol. Its IUPAC name is [(2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] methanesulfonate.
| Compound Name | [(2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] methanesulfonate |
|---|---|
| PubChem CID | 86714750 |
| Molecular Formula | C11H17ClFN3O3S |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | [(2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] methanesulfonate |
| SMILES | CC(C)(C)[C@@H](COS(C)(=O)=O)Nc1nc(Cl)ncc1F |
| InChI | InChI=1S/C11H17ClFN3O3S/c1-11(2,3)8(6-19-20(4,17)18)15-9-7(13)5-14-10(12)16-9/h5,8H,6H2,1-4H3,(H,14,15,16)/t8-/m1/s1 |
| InChIKey | BGUYNPATMDNWCR-MRVPVSSYSA-N |
| XLogP | 2.07 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|