C22H25ClN6O3 — CID 86716707
tert-butyl (3R)-3-[[2-(2-chloro-4-pyridinyl)-5-methoxypyrido[3,4-d]pyrimidin-4-yl]amino]pyrrolidine-1-carboxylate (PubChem CID 86716707) has the molecular formula C22H25ClN6O3 and a molecular weight of 456.93 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[2-(2-chloro-4-pyridinyl)-5-methoxypyrido[3,4-d]pyrimidin-4-yl]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[2-(2-chloro-4-pyridinyl)-5-methoxypyrido[3,4-d]pyrimidin-4-yl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86716707 |
| Molecular Formula | C22H25ClN6O3 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | tert-butyl (3R)-3-[[2-(2-chloro-4-pyridinyl)-5-methoxypyrido[3,4-d]pyrimidin-4-yl]amino]pyrrolidine-1-carboxylate |
| SMILES | COc1cncc2nc(-c3ccnc(Cl)c3)nc(N[C@@H]3CCN(C(=O)OC(C)(C)C)C3)c12 |
| InChI | InChI=1S/C22H25ClN6O3/c1-22(2,3)32-21(30)29-8-6-14(12-29)26-20-18-15(10-24-11-16(18)31-4)27-19(28-20)13-5-7-25-17(23)9-13/h5,7,9-11,14H,6,8,12H2,1-4H3,(H,26,27,28)/t14-/m1/s1 |
| InChIKey | WVBAPBWVACVPCR-CQSZACIVSA-N |
| XLogP | 4.17 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|