C13H24O3 — CID 86721304
1-(2,2-diethoxyethoxy)but-3-enylcyclopropane (PubChem CID 86721304) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 1-(2,2-diethoxyethoxy)but-3-enylcyclopropane.
| Compound Name | 1-(2,2-diethoxyethoxy)but-3-enylcyclopropane |
|---|---|
| PubChem CID | 86721304 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 1-(2,2-diethoxyethoxy)but-3-enylcyclopropane |
| SMILES | C=CCC(OCC(OCC)OCC)C1CC1 |
| InChI | InChI=1S/C13H24O3/c1-4-7-12(11-8-9-11)16-10-13(14-5-2)15-6-3/h4,11-13H,1,5-10H2,2-3H3 |
| InChIKey | RATNZNZCEZATHC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|