C16H18INO3 — CID 86725304
ethyl 7-iodo-10-oxo-1,2,4,5,8,9-hexahydrocyclopenta[i][3]benzazepine-3-carboxylate (PubChem CID 86725304) has the molecular formula C16H18INO3 and a molecular weight of 399.23 g/mol. Its IUPAC name is ethyl 7-iodo-10-oxo-1,2,4,5,8,9-hexahydrocyclopenta[i][3]benzazepine-3-carboxylate.
| Compound Name | ethyl 7-iodo-10-oxo-1,2,4,5,8,9-hexahydrocyclopenta[i][3]benzazepine-3-carboxylate |
|---|---|
| PubChem CID | 86725304 |
| Molecular Formula | C16H18INO3 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | ethyl 7-iodo-10-oxo-1,2,4,5,8,9-hexahydrocyclopenta[i][3]benzazepine-3-carboxylate |
| SMILES | CCOC(=O)N1CCc2cc(I)c3c(c2CC1)C(=O)CC3 |
| InChI | InChI=1S/C16H18INO3/c1-2-21-16(20)18-7-5-10-9-13(17)12-3-4-14(19)15(12)11(10)6-8-18/h9H,2-8H2,1H3 |
| InChIKey | GBMQAMNRAUBKKQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|