C19H26INO2 — CID 86725334
propyl 7-iodo-10,10-dimethyl-1,2,4,5,8,9-hexahydrocyclopenta[i][3]benzazepine-3-carboxylate (PubChem CID 86725334) has the molecular formula C19H26INO2 and a molecular weight of 427.33 g/mol. Its IUPAC name is propyl 7-iodo-10,10-dimethyl-1,2,4,5,8,9-hexahydrocyclopenta[i][3]benzazepine-3-carboxylate.
| Compound Name | propyl 7-iodo-10,10-dimethyl-1,2,4,5,8,9-hexahydrocyclopenta[i][3]benzazepine-3-carboxylate |
|---|---|
| PubChem CID | 86725334 |
| Molecular Formula | C19H26INO2 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | propyl 7-iodo-10,10-dimethyl-1,2,4,5,8,9-hexahydrocyclopenta[i][3]benzazepine-3-carboxylate |
| SMILES | CCCOC(=O)N1CCc2cc(I)c3c(c2CC1)C(C)(C)CC3 |
| InChI | InChI=1S/C19H26INO2/c1-4-11-23-18(22)21-9-6-13-12-16(20)15-5-8-19(2,3)17(15)14(13)7-10-21/h12H,4-11H2,1-3H3 |
| InChIKey | AKOAXTAOOUWLRI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|