C16H20INO2 — CID 141413221
7-iodo-10,10-dimethyl-1,2,4,5,8,9-hexahydrocyclopenta[i][3]benzazepine-3-carboxylic acid (PubChem CID 141413221) has the molecular formula C16H20INO2 and a molecular weight of 385.25 g/mol. Its IUPAC name is 7-iodo-10,10-dimethyl-1,2,4,5,8,9-hexahydrocyclopenta[i][3]benzazepine-3-carboxylic acid.
| Compound Name | 7-iodo-10,10-dimethyl-1,2,4,5,8,9-hexahydrocyclopenta[i][3]benzazepine-3-carboxylic acid |
|---|---|
| PubChem CID | 141413221 |
| Molecular Formula | C16H20INO2 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 7-iodo-10,10-dimethyl-1,2,4,5,8,9-hexahydrocyclopenta[i][3]benzazepine-3-carboxylic acid |
| SMILES | CC1(C)CCc2c(I)cc3c(c21)CCN(C(=O)O)CC3 |
| InChI | InChI=1S/C16H20INO2/c1-16(2)6-3-12-13(17)9-10-4-7-18(15(19)20)8-5-11(10)14(12)16/h9H,3-8H2,1-2H3,(H,19,20) |
| InChIKey | HESXUHJGCDDVCQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|