C22H25FN2O3 — CID 86731631
4-[(1S)-1-[[(2R)-1-[(3-fluorophenyl)methyl]piperidine-2-carbonyl]amino]ethyl]benzoic acid (PubChem CID 86731631) has the molecular formula C22H25FN2O3 and a molecular weight of 384.45 g/mol. Its IUPAC name is 4-[(1S)-1-[[(2R)-1-[(3-fluorophenyl)methyl]piperidine-2-carbonyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[(1S)-1-[[(2R)-1-[(3-fluorophenyl)methyl]piperidine-2-carbonyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 86731631 |
| Molecular Formula | C22H25FN2O3 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 4-[(1S)-1-[[(2R)-1-[(3-fluorophenyl)methyl]piperidine-2-carbonyl]amino]ethyl]benzoic acid |
| SMILES | C[C@H](NC(=O)[C@H]1CCCCN1Cc1cccc(F)c1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H25FN2O3/c1-15(17-8-10-18(11-9-17)22(27)28)24-21(26)20-7-2-3-12-25(20)14-16-5-4-6-19(23)13-16/h4-6,8-11,13,15,20H,2-3,7,12,14H2,1H3,(H,24,26)(H,27,28)/t15-,20+/m0/s1 |
| InChIKey | BLEFUBBWBVJJMR-MGPUTAFESA-N |
| XLogP | 3.76 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |