C30H38N2O2S — CID 86734353
N-[2-(diethylamino)ethyl]-N-[4-(2,2-diphenylethenyl)phenyl]butane-1-sulfonamide (PubChem CID 86734353) has the molecular formula C30H38N2O2S and a molecular weight of 490.71 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-[4-(2,2-diphenylethenyl)phenyl]butane-1-sulfonamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N-[4-(2,2-diphenylethenyl)phenyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 86734353 |
| Molecular Formula | C30H38N2O2S |
| Molecular Weight | 490.71 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-[4-(2,2-diphenylethenyl)phenyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)N(CCN(CC)CC)c1ccc(C=C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H38N2O2S/c1-4-7-24-35(33,34)32(23-22-31(5-2)6-3)29-20-18-26(19-21-29)25-30(27-14-10-8-11-15-27)28-16-12-9-13-17-28/h8-21,25H,4-7,22-24H2,1-3H3 |
| InChIKey | DJWLTZOEMANZOT-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.71 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|