C8H12N4O3 — CID 86735451
butyl (2R,3R)-3-azido-4-oxoazetidine-2-carboxylate (PubChem CID 86735451) has the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. Its IUPAC name is butyl (2R,3R)-3-azido-4-oxoazetidine-2-carboxylate.
| Compound Name | butyl (2R,3R)-3-azido-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 86735451 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | butyl (2R,3R)-3-azido-4-oxoazetidine-2-carboxylate |
| SMILES | CCCCOC(=O)[C@@H]1NC(=O)[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C8H12N4O3/c1-2-3-4-15-8(14)6-5(11-12-9)7(13)10-6/h5-6H,2-4H2,1H3,(H,10,13)/t5-,6-/m1/s1 |
| InChIKey | HFLHXWUUCIEDHK-PHDIDXHHSA-N |
| XLogP | 0.51 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|