C29H44O6 — CID 86735945
methyl (E)-6-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-diformyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hept-2-enoate (PubChem CID 86735945) has the molecular formula C29H44O6 and a molecular weight of 488.67 g/mol. Its IUPAC name is methyl (E)-6-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-diformyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hept-2-enoate.
| Compound Name | methyl (E)-6-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-diformyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hept-2-enoate |
|---|---|
| PubChem CID | 86735945 |
| Molecular Formula | C29H44O6 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | methyl (E)-6-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-diformyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]hept-2-enoate |
| SMILES | COC(=O)/C=C/CCC(C)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](OC=O)CC[C@]4(C)[C@H]3C[C@H](OC=O)[C@]12C |
| InChI | InChI=1S/C29H44O6/c1-19(7-5-6-8-27(32)33-4)23-11-12-24-22-10-9-20-15-21(34-17-30)13-14-28(20,2)25(22)16-26(35-18-31)29(23,24)3/h6,8,17-26H,5,7,9-16H2,1-4H3/b8-6+/t19?,20-,21-,22+,23-,24+,25+,26+,28+,29-/m1/s1 |
| InChIKey | NJEHQVXEIRSHCI-LZFGGMOXSA-N |
| XLogP | 5.48 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|