C21H22N4O6 — CID 86736079
(Z)-but-2-enedioic acid;3-(morpholin-2-ylmethyl)-1-phenylimidazo[4,5-b]pyridin-2-one (PubChem CID 86736079) has the molecular formula C21H22N4O6 and a molecular weight of 426.43 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;3-(morpholin-2-ylmethyl)-1-phenylimidazo[4,5-b]pyridin-2-one.
| Compound Name | (Z)-but-2-enedioic acid;3-(morpholin-2-ylmethyl)-1-phenylimidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 86736079 |
| Molecular Formula | C21H22N4O6 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | (Z)-but-2-enedioic acid;3-(morpholin-2-ylmethyl)-1-phenylimidazo[4,5-b]pyridin-2-one |
| SMILES | O=C(O)/C=C\C(=O)O.O=c1n(CC2CNCCO2)c2ncccc2n1-c1ccccc1 |
| InChI | InChI=1S/C17H18N4O2.C4H4O4/c22-17-20(12-14-11-18-9-10-23-14)16-15(7-4-8-19-16)21(17)13-5-2-1-3-6-13;5-3(6)1-2-4(7)8/h1-8,14,18H,9-12H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | LPXOKWVJNYWQIK-BTJKTKAUSA-N |
| XLogP | 0.89 |
| TPSA | 135.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|