C23H43N13O9 — CID 86737959
(2S)-1-[(2S)-2-[[(2S,8S)-2,6-diamino-11-(diaminomethylideneamino)-8-nitramido-7-oxoundecanoyl]-nitroamino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 86737959) has the molecular formula C23H43N13O9 and a molecular weight of 645.68 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[[(2S,8S)-2,6-diamino-11-(diaminomethylideneamino)-8-nitramido-7-oxoundecanoyl]-nitroamino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-2-[[(2S,8S)-2,6-diamino-11-(diaminomethylideneamino)-8-nitramido-7-oxoundecanoyl]-nitroamino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 86737959 |
| Molecular Formula | C23H43N13O9 |
| Molecular Weight | 645.68 g/mol |
| Exact Mass | 645.33 |
| IUPAC Name | (2S)-1-[(2S)-2-[[(2S,8S)-2,6-diamino-11-(diaminomethylideneamino)-8-nitramido-7-oxoundecanoyl]-nitroamino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NC(N)=NCCC[C@H](N[N+](=O)[O-])C(=O)C(N)CCC[C@H](N)C(=O)N([C@@H](CCCN=C(N)N)C(=O)N1CCC[C@H]1C(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C23H43N13O9/c24-13(18(37)15(32-35(42)43)7-2-10-30-22(26)27)5-1-6-14(25)19(38)34(36(44)45)16(8-3-11-31-23(28)29)20(39)33-12-4-9-17(33)21(40)41/h13-17,32H,1-12,24-25H2,(H,40,41)(H4,26,27,30)(H4,28,29,31)/t13?,14-,15-,16-,17-/m0/s1 |
| InChIKey | OSMBBBWIIAUTPB-QKSACFKYSA-N |
| XLogP | -3.90 |
| TPSA | 374.14 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.68 |
| LogP ≤ 5 | -3.90 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|