C9H14N4O2 — CID 86738590
2-hydroxyimino-3-imidazol-1-yl-N,3-dimethylbutanamide (PubChem CID 86738590) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is 2-hydroxyimino-3-imidazol-1-yl-N,3-dimethylbutanamide.
| Compound Name | 2-hydroxyimino-3-imidazol-1-yl-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 86738590 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 2-hydroxyimino-3-imidazol-1-yl-N,3-dimethylbutanamide |
| SMILES | CNC(=O)C(=NO)C(C)(C)n1ccnc1 |
| InChI | InChI=1S/C9H14N4O2/c1-9(2,13-5-4-11-6-13)7(12-15)8(14)10-3/h4-6,15H,1-3H3,(H,10,14) |
| InChIKey | MKIVOTDMVGVRHF-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|