C9H23N2O3PS2 — CID 86742742
N-[[butan-2-ylsulfanyl(ethyl)phosphoryl]-methylsulfamoyl]-N-methylmethanamine (PubChem CID 86742742) has the molecular formula C9H23N2O3PS2 and a molecular weight of 302.40 g/mol. Its IUPAC name is N-[[butan-2-ylsulfanyl(ethyl)phosphoryl]-methylsulfamoyl]-N-methylmethanamine.
| Compound Name | N-[[butan-2-ylsulfanyl(ethyl)phosphoryl]-methylsulfamoyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 86742742 |
| Molecular Formula | C9H23N2O3PS2 |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-[[butan-2-ylsulfanyl(ethyl)phosphoryl]-methylsulfamoyl]-N-methylmethanamine |
| SMILES | CCC(C)SP(=O)(CC)N(C)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C9H23N2O3PS2/c1-7-9(3)16-15(12,8-2)11(6)17(13,14)10(4)5/h9H,7-8H2,1-6H3 |
| InChIKey | ZXIVLKJLESLKHO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|