C9H21N2O2PS — CID 54113607
N-[butan-2-ylsulfanyl(ethylamino)phosphoryl]-N-ethylformamide (PubChem CID 54113607) has the molecular formula C9H21N2O2PS and a molecular weight of 252.32 g/mol. Its IUPAC name is N-[butan-2-ylsulfanyl(ethylamino)phosphoryl]-N-ethylformamide.
| Compound Name | N-[butan-2-ylsulfanyl(ethylamino)phosphoryl]-N-ethylformamide |
|---|---|
| PubChem CID | 54113607 |
| Molecular Formula | C9H21N2O2PS |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-[butan-2-ylsulfanyl(ethylamino)phosphoryl]-N-ethylformamide |
| SMILES | CCNP(=O)(SC(C)CC)N(C=O)CC |
| InChI | InChI=1S/C9H21N2O2PS/c1-5-9(4)15-14(13,10-6-2)11(7-3)8-12/h8-9H,5-7H2,1-4H3,(H,10,13) |
| InChIKey | NIUIQJYDBBNTEA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|