C9H19N2O2PS — CID 88784059
N-[butan-2-ylsulfanyl(methylamino)phosphoryl]-N-methylprop-2-enamide (PubChem CID 88784059) has the molecular formula C9H19N2O2PS and a molecular weight of 250.30 g/mol. Its IUPAC name is N-[butan-2-ylsulfanyl(methylamino)phosphoryl]-N-methylprop-2-enamide.
| Compound Name | N-[butan-2-ylsulfanyl(methylamino)phosphoryl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 88784059 |
| Molecular Formula | C9H19N2O2PS |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | N-[butan-2-ylsulfanyl(methylamino)phosphoryl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)P(=O)(NC)SC(C)CC |
| InChI | InChI=1S/C9H19N2O2PS/c1-6-8(3)15-14(13,10-4)11(5)9(12)7-2/h7-8H,2,6H2,1,3-5H3,(H,10,13) |
| InChIKey | KIPZAUWTUNEFBF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|