C13H29N2O2PS — CID 88783800
N-methyl-N-[methylamino(2-methylpropylsulfanyl)phosphoryl]heptanamide (PubChem CID 88783800) has the molecular formula C13H29N2O2PS and a molecular weight of 308.43 g/mol. Its IUPAC name is N-methyl-N-[methylamino(2-methylpropylsulfanyl)phosphoryl]heptanamide.
| Compound Name | N-methyl-N-[methylamino(2-methylpropylsulfanyl)phosphoryl]heptanamide |
|---|---|
| PubChem CID | 88783800 |
| Molecular Formula | C13H29N2O2PS |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | N-methyl-N-[methylamino(2-methylpropylsulfanyl)phosphoryl]heptanamide |
| SMILES | CCCCCCC(=O)N(C)P(=O)(NC)SCC(C)C |
| InChI | InChI=1S/C13H29N2O2PS/c1-6-7-8-9-10-13(16)15(5)18(17,14-4)19-11-12(2)3/h12H,6-11H2,1-5H3,(H,14,17) |
| InChIKey | QRMYHFWEIZNBRL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|