About S-propyl 2-[[butan-2-ylsulfanyl-[formyl(methyl)amino]phosphoryl]-methylamino]-2-oxoethanethioate
S-propyl 2-[[butan-2-ylsulfanyl-[formyl(methyl)amino]phosphoryl]-methylamino]-2-oxoethanethioate (PubChem CID 54293744) has the molecular formula C12H23N2O4PS2
and a molecular weight of 354.43 g/mol. Its IUPAC name is S-propyl 2-[[butan-2-ylsulfanyl-[formyl(methyl)amino]phosphoryl]-methylamino]-2-oxoethanethioate.
Molecular Properties
| Compound Name | S-propyl 2-[[butan-2-ylsulfanyl-[formyl(methyl)amino]phosphoryl]-methylamino]-2-oxoethanethioate |
| PubChem CID | 54293744 |
| Molecular Formula | C12H23N2O4PS2 |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | S-propyl 2-[[butan-2-ylsulfanyl-[formyl(methyl)amino]phosphoryl]-methylamino]-2-oxoethanethioate |
| SMILES | CCCSC(=O)C(=O)N(C)P(=O)(SC(C)CC)N(C)C=O |
| InChI | InChI=1S/C12H23N2O4PS2/c1-6-8-20-12(17)11(16)14(5)19(18,13(4)9-15)21-10(3)7-2/h9-10H,6-8H2,1-5H3 |
| InChIKey | RZIFIBTWYQDYCU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-propyl 2-[[butan-2-ylsulfanyl-[formyl(methyl)amino]phosphoryl]-methylamino]-2-oxoethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-propyl 2-[[butan-2-ylsulfanyl-[formyl(methyl)amino]phosphoryl]-methylamino]-2-oxoethanethioate?
The IUPAC name of S-propyl 2-[[butan-2-ylsulfanyl-[formyl(methyl)amino]phosphoryl]-methylamino]-2-oxoethanethioate (CID 54293744) is S-propyl 2-[[butan-2-ylsulfanyl-[formyl(methyl)amino]phosphoryl]-methylamino]-2-oxoethanethioate.
What is the SMILES notation for S-propyl 2-[[butan-2-ylsulfanyl-[formyl(methyl)amino]phosphoryl]-methylamino]-2-oxoethanethioate?
The canonical SMILES for S-propyl 2-[[butan-2-ylsulfanyl-[formyl(methyl)amino]phosphoryl]-methylamino]-2-oxoethanethioate is CCCSC(=O)C(=O)N(C)P(=O)(SC(C)CC)N(C)C=O.
What is the InChIKey of S-propyl 2-[[butan-2-ylsulfanyl-[formyl(methyl)amino]phosphoryl]-methylamino]-2-oxoethanethioate?
The InChIKey is RZIFIBTWYQDYCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N2O4PS2/c1-6-8-20-12(17)11(16)14(5)19(18,13(4)9-15)21-10(3)7-2/h9-10H,6-8H2,1-5H3.
What are the key properties of S-propyl 2-[[butan-2-ylsulfanyl-[formyl(methyl)amino]phosphoryl]-methylamino]-2-oxoethanethioate?
S-propyl 2-[[butan-2-ylsulfanyl-[formyl(methyl)amino]phosphoryl]-methylamino]-2-oxoethanethioate has a molecular weight of 354.43 g/mol, XLogP of 2.84, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-propyl 2-[[butan-2-ylsulfanyl-[formyl(methyl)amino]phosphoryl]-methylamino]-2-oxoethanethioate is sourced from PubChem (CID 54293744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).