C22H36N2O8 — CID 86743105
bis(ethyl 1,2-dimethyl-1,2,3,6-tetrahydropyridin-1-ium-5-carboxylate);oxalate (PubChem CID 86743105) has the molecular formula C22H36N2O8 and a molecular weight of 456.54 g/mol. Its IUPAC name is bis(ethyl 1,2-dimethyl-1,2,3,6-tetrahydropyridin-1-ium-5-carboxylate);oxalate.
| Compound Name | bis(ethyl 1,2-dimethyl-1,2,3,6-tetrahydropyridin-1-ium-5-carboxylate);oxalate |
|---|---|
| PubChem CID | 86743105 |
| Molecular Formula | C22H36N2O8 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | bis(ethyl 1,2-dimethyl-1,2,3,6-tetrahydropyridin-1-ium-5-carboxylate);oxalate |
| SMILES | CCOC(=O)C1=CCC(C)[NH+](C)C1.CCOC(=O)C1=CCC(C)[NH+](C)C1.O=C([O-])C(=O)[O-] |
| InChI | InChI=1S/2C10H17NO2.C2H2O4/c2*1-4-13-10(12)9-6-5-8(2)11(3)7-9;3-1(4)2(5)6/h2*6,8H,4-5,7H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | OKADEHRGEYLPEE-UHFFFAOYSA-N |
| XLogP | -3.95 |
| TPSA | 141.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | -3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|