About 2-(2-methoxyethoxy)ethyl (E)-4-hydroxy-6-(4-methoxyphenyl)hex-5-en-2-ynoate
2-(2-methoxyethoxy)ethyl (E)-4-hydroxy-6-(4-methoxyphenyl)hex-5-en-2-ynoate (PubChem CID 86743960) has the molecular formula C18H22O6
and a molecular weight of 334.37 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl (E)-4-hydroxy-6-(4-methoxyphenyl)hex-5-en-2-ynoate.
Molecular Properties
| Compound Name | 2-(2-methoxyethoxy)ethyl (E)-4-hydroxy-6-(4-methoxyphenyl)hex-5-en-2-ynoate |
| PubChem CID | 86743960 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl (E)-4-hydroxy-6-(4-methoxyphenyl)hex-5-en-2-ynoate |
| SMILES | COCCOCCOC(=O)C#CC(O)/C=C/c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H22O6/c1-21-11-12-23-13-14-24-18(20)10-7-16(19)6-3-15-4-8-17(22-2)9-5-15/h3-6,8-9,16,19H,11-14H2,1-2H3/b6-3+ |
| InChIKey | VMLBYNCBJGRTOW-ZZXKWVIFSA-N |
| XLogP | 1.28 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methoxyethoxy)ethyl (E)-4-hydroxy-6-(4-methoxyphenyl)hex-5-en-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyethoxy)ethyl (E)-4-hydroxy-6-(4-methoxyphenyl)hex-5-en-2-ynoate?
The IUPAC name of 2-(2-methoxyethoxy)ethyl (E)-4-hydroxy-6-(4-methoxyphenyl)hex-5-en-2-ynoate (CID 86743960) is 2-(2-methoxyethoxy)ethyl (E)-4-hydroxy-6-(4-methoxyphenyl)hex-5-en-2-ynoate.
What is the SMILES notation for 2-(2-methoxyethoxy)ethyl (E)-4-hydroxy-6-(4-methoxyphenyl)hex-5-en-2-ynoate?
The canonical SMILES for 2-(2-methoxyethoxy)ethyl (E)-4-hydroxy-6-(4-methoxyphenyl)hex-5-en-2-ynoate is COCCOCCOC(=O)C#CC(O)/C=C/c1ccc(OC)cc1.
What is the InChIKey of 2-(2-methoxyethoxy)ethyl (E)-4-hydroxy-6-(4-methoxyphenyl)hex-5-en-2-ynoate?
The InChIKey is VMLBYNCBJGRTOW-ZZXKWVIFSA-N. The full InChI is InChI=1S/C18H22O6/c1-21-11-12-23-13-14-24-18(20)10-7-16(19)6-3-15-4-8-17(22-2)9-5-15/h3-6,8-9,16,19H,11-14H2,1-2H3/b6-3+.
What are the key properties of 2-(2-methoxyethoxy)ethyl (E)-4-hydroxy-6-(4-methoxyphenyl)hex-5-en-2-ynoate?
2-(2-methoxyethoxy)ethyl (E)-4-hydroxy-6-(4-methoxyphenyl)hex-5-en-2-ynoate has a molecular weight of 334.37 g/mol, XLogP of 1.28, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyethoxy)ethyl (E)-4-hydroxy-6-(4-methoxyphenyl)hex-5-en-2-ynoate is sourced from PubChem (CID 86743960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).