C22H28N2O5 — CID 86746312
diethyl 2-(dimethylamino)-4-(2-formylphenyl)-1,6-dimethyl-4H-pyridine-3,5-dicarboxylate (PubChem CID 86746312) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is diethyl 2-(dimethylamino)-4-(2-formylphenyl)-1,6-dimethyl-4H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2-(dimethylamino)-4-(2-formylphenyl)-1,6-dimethyl-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 86746312 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | diethyl 2-(dimethylamino)-4-(2-formylphenyl)-1,6-dimethyl-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N(C)C(N(C)C)=C(C(=O)OCC)C1c1ccccc1C=O |
| InChI | InChI=1S/C22H28N2O5/c1-7-28-21(26)17-14(3)24(6)20(23(4)5)19(22(27)29-8-2)18(17)16-12-10-9-11-15(16)13-25/h9-13,18H,7-8H2,1-6H3 |
| InChIKey | MZRBTVYOWKJNGZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|