C18H14F3NO4 — CID 86747146
methyl 2-[2-[(Z)-N-methoxy-C-[3-(trifluoromethyl)phenyl]carbonimidoyl]phenyl]-2-oxoacetate (PubChem CID 86747146) has the molecular formula C18H14F3NO4 and a molecular weight of 365.31 g/mol. Its IUPAC name is methyl 2-[2-[(Z)-N-methoxy-C-[3-(trifluoromethyl)phenyl]carbonimidoyl]phenyl]-2-oxoacetate.
| Compound Name | methyl 2-[2-[(Z)-N-methoxy-C-[3-(trifluoromethyl)phenyl]carbonimidoyl]phenyl]-2-oxoacetate |
|---|---|
| PubChem CID | 86747146 |
| Molecular Formula | C18H14F3NO4 |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | methyl 2-[2-[(Z)-N-methoxy-C-[3-(trifluoromethyl)phenyl]carbonimidoyl]phenyl]-2-oxoacetate |
| SMILES | CO/N=C(/c1cccc(C(F)(F)F)c1)c1ccccc1C(=O)C(=O)OC |
| InChI | InChI=1S/C18H14F3NO4/c1-25-17(24)16(23)14-9-4-3-8-13(14)15(22-26-2)11-6-5-7-12(10-11)18(19,20)21/h3-10H,1-2H3/b22-15- |
| InChIKey | ZGSUSDCZCRCYNB-JCMHNJIXSA-N |
| XLogP | 3.46 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|