C24H33NO4S2 — CID 86747616
2-(2,3-dihydro-1-benzothiophen-5-yl)-N-[[(1R)-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-N-methylethanamine;methanesulfonic acid (PubChem CID 86747616) has the molecular formula C24H33NO4S2 and a molecular weight of 463.67 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzothiophen-5-yl)-N-[[(1R)-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-N-methylethanamine;methanesulfonic acid.
| Compound Name | 2-(2,3-dihydro-1-benzothiophen-5-yl)-N-[[(1R)-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-N-methylethanamine;methanesulfonic acid |
|---|---|
| PubChem CID | 86747616 |
| Molecular Formula | C24H33NO4S2 |
| Molecular Weight | 463.67 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 2-(2,3-dihydro-1-benzothiophen-5-yl)-N-[[(1R)-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-N-methylethanamine;methanesulfonic acid |
| SMILES | COc1cccc2c1CCC[C@H]2CN(C)CCc1ccc2c(c1)CCS2.CS(=O)(=O)O |
| InChI | InChI=1S/C23H29NOS.CH4O3S/c1-24(13-11-17-9-10-23-18(15-17)12-14-26-23)16-19-5-3-7-21-20(19)6-4-8-22(21)25-2;1-5(2,3)4/h4,6,8-10,15,19H,3,5,7,11-14,16H2,1-2H3;1H3,(H,2,3,4)/t19-;/m0./s1 |
| InChIKey | ONBZZYZOCDAMHF-FYZYNONXSA-N |
| XLogP | 4.44 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.67 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|