C24H30F3N3O3S — CID 67875759
1,1,1-trifluoro-N-[6-[2-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl-methylamino]ethyl]-2,3-dihydroindol-1-yl]methanesulfonamide (PubChem CID 67875759) has the molecular formula C24H30F3N3O3S and a molecular weight of 497.58 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[6-[2-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl-methylamino]ethyl]-2,3-dihydroindol-1-yl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[6-[2-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl-methylamino]ethyl]-2,3-dihydroindol-1-yl]methanesulfonamide |
|---|---|
| PubChem CID | 67875759 |
| Molecular Formula | C24H30F3N3O3S |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 1,1,1-trifluoro-N-[6-[2-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl-methylamino]ethyl]-2,3-dihydroindol-1-yl]methanesulfonamide |
| SMILES | COc1cccc2c1CCCC2CN(C)CCc1ccc2c(c1)N(NS(=O)(=O)C(F)(F)F)CC2 |
| InChI | InChI=1S/C24H30F3N3O3S/c1-29(16-19-5-3-7-21-20(19)6-4-8-23(21)33-2)13-11-17-9-10-18-12-14-30(22(18)15-17)28-34(31,32)24(25,26)27/h4,6,8-10,15,19,28H,3,5,7,11-14,16H2,1-2H3 |
| InChIKey | UTNYOZJJIXCINZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |