C16H19F3O — CID 86748404
1,2,3-trifluoro-5-[2-[4-(methoxymethylidene)cyclohexyl]ethyl]benzene (PubChem CID 86748404) has the molecular formula C16H19F3O and a molecular weight of 284.32 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[2-[4-(methoxymethylidene)cyclohexyl]ethyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[2-[4-(methoxymethylidene)cyclohexyl]ethyl]benzene |
|---|---|
| PubChem CID | 86748404 |
| Molecular Formula | C16H19F3O |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 1,2,3-trifluoro-5-[2-[4-(methoxymethylidene)cyclohexyl]ethyl]benzene |
| SMILES | COC=C1CCC(CCc2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C16H19F3O/c1-20-10-12-5-2-11(3-6-12)4-7-13-8-14(17)16(19)15(18)9-13/h8-11H,2-7H2,1H3/b12-10- |
| InChIKey | PBZDZGHUODSAGD-BENRWUELSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|