C17H21N5O2S — CID 86750855
(2E)-2-[2-(dimethylaminomethylideneamino)-1,3-thiazol-4-yl]-2-methoxyimino-N-(2-phenylethyl)acetamide (PubChem CID 86750855) has the molecular formula C17H21N5O2S and a molecular weight of 359.46 g/mol. Its IUPAC name is (2E)-2-[2-(dimethylaminomethylideneamino)-1,3-thiazol-4-yl]-2-methoxyimino-N-(2-phenylethyl)acetamide.
| Compound Name | (2E)-2-[2-(dimethylaminomethylideneamino)-1,3-thiazol-4-yl]-2-methoxyimino-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 86750855 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (2E)-2-[2-(dimethylaminomethylideneamino)-1,3-thiazol-4-yl]-2-methoxyimino-N-(2-phenylethyl)acetamide |
| SMILES | CO/N=C(/C(=O)NCCc1ccccc1)c1csc(N=CN(C)C)n1 |
| InChI | InChI=1S/C17H21N5O2S/c1-22(2)12-19-17-20-14(11-25-17)15(21-24-3)16(23)18-10-9-13-7-5-4-6-8-13/h4-8,11-12H,9-10H2,1-3H3,(H,18,23)/b19-12?,21-15+ |
| InChIKey | UTCMTKYKPHMLEV-OXBKUZOJSA-N |
| XLogP | 2.07 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|