2-(2-anilino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl chloride

C12H10ClN3O2S — CID 142637273

IUPAC2-(2-anilino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl chloride
SMILESCON=C(C(=O)Cl)c1csc(Nc2ccccc2)n1
InChIInChI=1S/C12H10ClN3O2S/c1-18-16-10(11(13)17)9-7-19-12(15-9)14-8-5-3-2-4-6-8/h2-7H,1H3,(H,14,15)
InChIKeyZQMZUKVCRWICPY-UHFFFAOYSA-N
MW295.75 g/mol
LogP3.00
Rot. Bonds5

About 2-(2-anilino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl chloride

2-(2-anilino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl chloride (PubChem CID 142637273) has the molecular formula C12H10ClN3O2S and a molecular weight of 295.75 g/mol. Its IUPAC name is 2-(2-anilino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl chloride.

Molecular Properties

Compound Name2-(2-anilino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl chloride
PubChem CID142637273
Molecular FormulaC12H10ClN3O2S
Molecular Weight295.75 g/mol
Exact Mass295.02
IUPAC Name2-(2-anilino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl chloride
SMILESCON=C(C(=O)Cl)c1csc(Nc2ccccc2)n1
InChIInChI=1S/C12H10ClN3O2S/c1-18-16-10(11(13)17)9-7-19-12(15-9)14-8-5-3-2-4-6-8/h2-7H,1H3,(H,14,15)
InChIKeyZQMZUKVCRWICPY-UHFFFAOYSA-N
XLogP3.00
TPSA63.58 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.75
LogP ≤ 53.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(2-anilino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-anilino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl chloride?
The IUPAC name of 2-(2-anilino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl chloride (CID 142637273) is 2-(2-anilino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl chloride.
What is the SMILES notation for 2-(2-anilino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl chloride?
The canonical SMILES for 2-(2-anilino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl chloride is CON=C(C(=O)Cl)c1csc(Nc2ccccc2)n1.
What is the InChIKey of 2-(2-anilino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl chloride?
The InChIKey is ZQMZUKVCRWICPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClN3O2S/c1-18-16-10(11(13)17)9-7-19-12(15-9)14-8-5-3-2-4-6-8/h2-7H,1H3,(H,14,15).
What are the key properties of 2-(2-anilino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl chloride?
2-(2-anilino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl chloride has a molecular weight of 295.75 g/mol, XLogP of 3.00, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-anilino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl chloride is sourced from PubChem (CID 142637273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).