C12H10ClN3O2S — CID 142637273
2-(2-anilino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl chloride (PubChem CID 142637273) has the molecular formula C12H10ClN3O2S and a molecular weight of 295.75 g/mol. Its IUPAC name is 2-(2-anilino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl chloride.
| Compound Name | 2-(2-anilino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl chloride |
|---|---|
| PubChem CID | 142637273 |
| Molecular Formula | C12H10ClN3O2S |
| Molecular Weight | 295.75 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 2-(2-anilino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl chloride |
| SMILES | CON=C(C(=O)Cl)c1csc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C12H10ClN3O2S/c1-18-16-10(11(13)17)9-7-19-12(15-9)14-8-5-3-2-4-6-8/h2-7H,1H3,(H,14,15) |
| InChIKey | ZQMZUKVCRWICPY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.75 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|