C12H25O5PS — CID 86751718
[(4S)-2-methyl-4-(methylsulfonylmethyl)-3-propan-2-ylhex-5-en-3-yl]phosphonic acid (PubChem CID 86751718) has the molecular formula C12H25O5PS and a molecular weight of 312.37 g/mol. Its IUPAC name is [(4S)-2-methyl-4-(methylsulfonylmethyl)-3-propan-2-ylhex-5-en-3-yl]phosphonic acid.
| Compound Name | [(4S)-2-methyl-4-(methylsulfonylmethyl)-3-propan-2-ylhex-5-en-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 86751718 |
| Molecular Formula | C12H25O5PS |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | [(4S)-2-methyl-4-(methylsulfonylmethyl)-3-propan-2-ylhex-5-en-3-yl]phosphonic acid |
| SMILES | C=C[C@H](CS(C)(=O)=O)C(C(C)C)(C(C)C)P(=O)(O)O |
| InChI | InChI=1S/C12H25O5PS/c1-7-11(8-19(6,16)17)12(9(2)3,10(4)5)18(13,14)15/h7,9-11H,1,8H2,2-6H3,(H2,13,14,15)/t11-/m1/s1 |
| InChIKey | QNICLQUPEWRTKP-LLVKDONJSA-N |
| XLogP | 2.06 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|