C20H30N2O7 — CID 86753339
methyl 2,6-dihydroxy-3-[[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]methyl]benzoate (PubChem CID 86753339) has the molecular formula C20H30N2O7 and a molecular weight of 410.47 g/mol. Its IUPAC name is methyl 2,6-dihydroxy-3-[[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]methyl]benzoate.
| Compound Name | methyl 2,6-dihydroxy-3-[[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]methyl]benzoate |
|---|---|
| PubChem CID | 86753339 |
| Molecular Formula | C20H30N2O7 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | methyl 2,6-dihydroxy-3-[[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]methyl]benzoate |
| SMILES | COC(=O)c1c(O)ccc(CNC(=O)CCCCCNC(=O)OC(C)(C)C)c1O |
| InChI | InChI=1S/C20H30N2O7/c1-20(2,3)29-19(27)21-11-7-5-6-8-15(24)22-12-13-9-10-14(23)16(17(13)25)18(26)28-4/h9-10,23,25H,5-8,11-12H2,1-4H3,(H,21,27)(H,22,24) |
| InChIKey | QISHXWRQSMPUPL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|