C18H16FNO5 — CID 8675827
[2-(3-fluorophenyl)-2-oxoethyl] 2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate (PubChem CID 8675827) has the molecular formula C18H16FNO5 and a molecular weight of 345.33 g/mol. Its IUPAC name is [2-(3-fluorophenyl)-2-oxoethyl] 2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate.
| Compound Name | [2-(3-fluorophenyl)-2-oxoethyl] 2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 8675827 |
| Molecular Formula | C18H16FNO5 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | [2-(3-fluorophenyl)-2-oxoethyl] 2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate |
| SMILES | O=C(CN1C(=O)[C@@H]2CC=CC[C@H]2C1=O)OCC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C18H16FNO5/c19-12-5-3-4-11(8-12)15(21)10-25-16(22)9-20-17(23)13-6-1-2-7-14(13)18(20)24/h1-5,8,13-14H,6-7,9-10H2/t13-,14-/m1/s1 |
| InChIKey | MBHPUSXQLOIELO-ZIAGYGMSSA-N |
| XLogP | 1.50 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|