C23H18FNO5 — CID 7931069
[4-(4-fluorobenzoyl)phenyl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate (PubChem CID 7931069) has the molecular formula C23H18FNO5 and a molecular weight of 407.40 g/mol. Its IUPAC name is [4-(4-fluorobenzoyl)phenyl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate.
| Compound Name | [4-(4-fluorobenzoyl)phenyl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 7931069 |
| Molecular Formula | C23H18FNO5 |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | [4-(4-fluorobenzoyl)phenyl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate |
| SMILES | O=C(CN1C(=O)[C@H]2CC=CC[C@@H]2C1=O)Oc1ccc(C(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H18FNO5/c24-16-9-5-14(6-10-16)21(27)15-7-11-17(12-8-15)30-20(26)13-25-22(28)18-3-1-2-4-19(18)23(25)29/h1-2,5-12,18-19H,3-4,13H2/t18-,19-/m0/s1 |
| InChIKey | HUQHDXIUGQJPLG-OALUTQOASA-N |
| XLogP | 2.91 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|