C19H16N8 — CID 86758760
4-azido-6-(benzimidazol-1-yl)-N-[(1S)-1-phenylethyl]pyrimidin-2-amine (PubChem CID 86758760) has the molecular formula C19H16N8 and a molecular weight of 356.39 g/mol. Its IUPAC name is 4-azido-6-(benzimidazol-1-yl)-N-[(1S)-1-phenylethyl]pyrimidin-2-amine.
| Compound Name | 4-azido-6-(benzimidazol-1-yl)-N-[(1S)-1-phenylethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 86758760 |
| Molecular Formula | C19H16N8 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 4-azido-6-(benzimidazol-1-yl)-N-[(1S)-1-phenylethyl]pyrimidin-2-amine |
| SMILES | C[C@H](Nc1nc(N=[N+]=[N-])cc(-n2cnc3ccccc32)n1)c1ccccc1 |
| InChI | InChI=1S/C19H16N8/c1-13(14-7-3-2-4-8-14)22-19-23-17(25-26-20)11-18(24-19)27-12-21-15-9-5-6-10-16(15)27/h2-13H,1H3,(H,22,23,24)/t13-/m0/s1 |
| InChIKey | FONXVMOZBFHQPU-ZDUSSCGKSA-N |
| XLogP | 4.93 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|