C35H44N4O4 — CID 86761538
tert-butyl N-[(2R)-4-[(3R)-3-[2-(3-methoxypropyl)benzimidazol-1-yl]piperidin-1-yl]-1-naphthalen-2-yl-4-oxobutan-2-yl]carbamate (PubChem CID 86761538) has the molecular formula C35H44N4O4 and a molecular weight of 584.76 g/mol. Its IUPAC name is tert-butyl N-[(2R)-4-[(3R)-3-[2-(3-methoxypropyl)benzimidazol-1-yl]piperidin-1-yl]-1-naphthalen-2-yl-4-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-4-[(3R)-3-[2-(3-methoxypropyl)benzimidazol-1-yl]piperidin-1-yl]-1-naphthalen-2-yl-4-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 86761538 |
| Molecular Formula | C35H44N4O4 |
| Molecular Weight | 584.76 g/mol |
| Exact Mass | 584.34 |
| IUPAC Name | tert-butyl N-[(2R)-4-[(3R)-3-[2-(3-methoxypropyl)benzimidazol-1-yl]piperidin-1-yl]-1-naphthalen-2-yl-4-oxobutan-2-yl]carbamate |
| SMILES | COCCCc1nc2ccccc2n1[C@@H]1CCCN(C(=O)C[C@@H](Cc2ccc3ccccc3c2)NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C35H44N4O4/c1-35(2,3)43-34(41)36-28(22-25-17-18-26-11-5-6-12-27(26)21-25)23-33(40)38-19-9-13-29(24-38)39-31-15-8-7-14-30(31)37-32(39)16-10-20-42-4/h5-8,11-12,14-15,17-18,21,28-29H,9-10,13,16,19-20,22-24H2,1-4H3,(H,36,41)/t28-,29-/m1/s1 |
| InChIKey | CGYXWMAYISSYHM-FQLXRVMXSA-N |
| XLogP | 6.46 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.76 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|