C30H24N4O2 — CID 86763274
5-[4-[2-(2-phenylethyl)imidazol-1-yl]phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione (PubChem CID 86763274) has the molecular formula C30H24N4O2 and a molecular weight of 472.55 g/mol. Its IUPAC name is 5-[4-[2-(2-phenylethyl)imidazol-1-yl]phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione.
| Compound Name | 5-[4-[2-(2-phenylethyl)imidazol-1-yl]phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 86763274 |
| Molecular Formula | C30H24N4O2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 5-[4-[2-(2-phenylethyl)imidazol-1-yl]phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione |
| SMILES | O=C1CC(=O)N(c2ccc(-n3ccnc3CCc3ccccc3)cc2)c2ccc3ccccc3c2N1 |
| InChI | InChI=1S/C30H24N4O2/c35-28-20-29(36)34(26-16-11-22-8-4-5-9-25(22)30(26)32-28)24-14-12-23(13-15-24)33-19-18-31-27(33)17-10-21-6-2-1-3-7-21/h1-9,11-16,18-19H,10,17,20H2,(H,32,35) |
| InChIKey | MPWFIZOJGJVUHY-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|