C22H16N2O4S — CID 86763873
N-(3-acetylphenyl)-4,7-dioxa-13-thia-11-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,8,10,12(16),14-hexaene-14-carboxamide (PubChem CID 86763873) has the molecular formula C22H16N2O4S and a molecular weight of 404.45 g/mol. Its IUPAC name is N-(3-acetylphenyl)-4,7-dioxa-13-thia-11-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,8,10,12(16),14-hexaene-14-carboxamide.
| Compound Name | N-(3-acetylphenyl)-4,7-dioxa-13-thia-11-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,8,10,12(16),14-hexaene-14-carboxamide |
|---|---|
| PubChem CID | 86763873 |
| Molecular Formula | C22H16N2O4S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | N-(3-acetylphenyl)-4,7-dioxa-13-thia-11-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,8,10,12(16),14-hexaene-14-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2cc3cc4cc5c(cc4nc3s2)OCCO5)c1 |
| InChI | InChI=1S/C22H16N2O4S/c1-12(25)13-3-2-4-16(8-13)23-21(26)20-10-15-7-14-9-18-19(28-6-5-27-18)11-17(14)24-22(15)29-20/h2-4,7-11H,5-6H2,1H3,(H,23,26) |
| InChIKey | OKBGVXUVEXFWSK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |