About 4-[3-[4-(dimethylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]propoxy]benzonitrile
4-[3-[4-(dimethylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]propoxy]benzonitrile (PubChem CID 86773045) has the molecular formula C19H23N5O
and a molecular weight of 337.43 g/mol. Its IUPAC name is 4-[3-[4-(dimethylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]propoxy]benzonitrile.
Molecular Properties
| Compound Name | 4-[3-[4-(dimethylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]propoxy]benzonitrile |
| PubChem CID | 86773045 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 4-[3-[4-(dimethylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]propoxy]benzonitrile |
| SMILES | CN(C)c1ncnc2c1CN(CCCOc1ccc(C#N)cc1)CC2 |
| InChI | InChI=1S/C19H23N5O/c1-23(2)19-17-13-24(10-8-18(17)21-14-22-19)9-3-11-25-16-6-4-15(12-20)5-7-16/h4-7,14H,3,8-11,13H2,1-2H3 |
| InChIKey | HQTDGIUFHOAERC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-[4-(dimethylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]propoxy]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[4-(dimethylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]propoxy]benzonitrile?
The IUPAC name of 4-[3-[4-(dimethylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]propoxy]benzonitrile (CID 86773045) is 4-[3-[4-(dimethylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]propoxy]benzonitrile.
What is the SMILES notation for 4-[3-[4-(dimethylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]propoxy]benzonitrile?
The canonical SMILES for 4-[3-[4-(dimethylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]propoxy]benzonitrile is CN(C)c1ncnc2c1CN(CCCOc1ccc(C#N)cc1)CC2.
What is the InChIKey of 4-[3-[4-(dimethylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]propoxy]benzonitrile?
The InChIKey is HQTDGIUFHOAERC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N5O/c1-23(2)19-17-13-24(10-8-18(17)21-14-22-19)9-3-11-25-16-6-4-15(12-20)5-7-16/h4-7,14H,3,8-11,13H2,1-2H3.
What are the key properties of 4-[3-[4-(dimethylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]propoxy]benzonitrile?
4-[3-[4-(dimethylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]propoxy]benzonitrile has a molecular weight of 337.43 g/mol, XLogP of 2.24, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[4-(dimethylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]propoxy]benzonitrile is sourced from PubChem (CID 86773045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).