C12H17N5O2 — CID 86774840
3-[3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)propyl]imidazolidine-2,4-dione (PubChem CID 86774840) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 3-[3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)propyl]imidazolidine-2,4-dione.
| Compound Name | 3-[3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 86774840 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 3-[3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)propyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1CCCN1CCn2ccnc2C1 |
| InChI | InChI=1S/C12H17N5O2/c18-11-8-14-12(19)17(11)4-1-3-15-6-7-16-5-2-13-10(16)9-15/h2,5H,1,3-4,6-9H2,(H,14,19) |
| InChIKey | LBHKVFFDYCKUEC-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|