C16H24N2O3S — CID 86779442
1-but-3-enylsulfonyl-4-[(4-methoxyphenyl)methyl]piperazine (PubChem CID 86779442) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is 1-but-3-enylsulfonyl-4-[(4-methoxyphenyl)methyl]piperazine.
| Compound Name | 1-but-3-enylsulfonyl-4-[(4-methoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 86779442 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-but-3-enylsulfonyl-4-[(4-methoxyphenyl)methyl]piperazine |
| SMILES | C=CCCS(=O)(=O)N1CCN(Cc2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C16H24N2O3S/c1-3-4-13-22(19,20)18-11-9-17(10-12-18)14-15-5-7-16(21-2)8-6-15/h3,5-8H,1,4,9-14H2,2H3 |
| InChIKey | LXQZNSOKCLDPEM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|