C13H19BrN2O2 — CID 86781248
[4-[[(5-bromo-4-methyl-2-pyridinyl)amino]methyl]oxan-4-yl]methanol (PubChem CID 86781248) has the molecular formula C13H19BrN2O2 and a molecular weight of 315.21 g/mol. Its IUPAC name is [4-[[(5-bromo-4-methyl-2-pyridinyl)amino]methyl]oxan-4-yl]methanol.
| Compound Name | [4-[[(5-bromo-4-methyl-2-pyridinyl)amino]methyl]oxan-4-yl]methanol |
|---|---|
| PubChem CID | 86781248 |
| Molecular Formula | C13H19BrN2O2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | [4-[[(5-bromo-4-methyl-2-pyridinyl)amino]methyl]oxan-4-yl]methanol |
| SMILES | Cc1cc(NCC2(CO)CCOCC2)ncc1Br |
| InChI | InChI=1S/C13H19BrN2O2/c1-10-6-12(15-7-11(10)14)16-8-13(9-17)2-4-18-5-3-13/h6-7,17H,2-5,8-9H2,1H3,(H,15,16) |
| InChIKey | ZUHNEVFXPNIYAI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |