About 1-(3-methoxyphenyl)ethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate
1-(3-methoxyphenyl)ethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate (PubChem CID 86784896) has the molecular formula C17H19NO4
and a molecular weight of 301.34 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)ethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate.
Molecular Properties
| Compound Name | 1-(3-methoxyphenyl)ethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate |
| PubChem CID | 86784896 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 1-(3-methoxyphenyl)ethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate |
| SMILES | CCc1cc(C(=O)OC(C)c2cccc(OC)c2)cc(=O)[nH]1 |
| InChI | InChI=1S/C17H19NO4/c1-4-14-8-13(10-16(19)18-14)17(20)22-11(2)12-6-5-7-15(9-12)21-3/h5-11H,4H2,1-3H3,(H,18,19) |
| InChIKey | OAMWIPMKWRGRQN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-methoxyphenyl)ethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methoxyphenyl)ethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate?
The IUPAC name of 1-(3-methoxyphenyl)ethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate (CID 86784896) is 1-(3-methoxyphenyl)ethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate.
What is the SMILES notation for 1-(3-methoxyphenyl)ethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate?
The canonical SMILES for 1-(3-methoxyphenyl)ethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate is CCc1cc(C(=O)OC(C)c2cccc(OC)c2)cc(=O)[nH]1.
What is the InChIKey of 1-(3-methoxyphenyl)ethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate?
The InChIKey is OAMWIPMKWRGRQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO4/c1-4-14-8-13(10-16(19)18-14)17(20)22-11(2)12-6-5-7-15(9-12)21-3/h5-11H,4H2,1-3H3,(H,18,19).
What are the key properties of 1-(3-methoxyphenyl)ethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate?
1-(3-methoxyphenyl)ethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate has a molecular weight of 301.34 g/mol, XLogP of 2.86, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methoxyphenyl)ethyl 2-ethyl-6-oxo-1H-pyridine-4-carboxylate is sourced from PubChem (CID 86784896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).