C18H22BrN3 — CID 86785782
1-[(3-bromo-4-methylphenyl)methyl]-4-(pyridin-4-ylmethyl)piperazine (PubChem CID 86785782) has the molecular formula C18H22BrN3 and a molecular weight of 360.30 g/mol. Its IUPAC name is 1-[(3-bromo-4-methylphenyl)methyl]-4-(pyridin-4-ylmethyl)piperazine.
| Compound Name | 1-[(3-bromo-4-methylphenyl)methyl]-4-(pyridin-4-ylmethyl)piperazine |
|---|---|
| PubChem CID | 86785782 |
| Molecular Formula | C18H22BrN3 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 1-[(3-bromo-4-methylphenyl)methyl]-4-(pyridin-4-ylmethyl)piperazine |
| SMILES | Cc1ccc(CN2CCN(Cc3ccncc3)CC2)cc1Br |
| InChI | InChI=1S/C18H22BrN3/c1-15-2-3-17(12-18(15)19)14-22-10-8-21(9-11-22)13-16-4-6-20-7-5-16/h2-7,12H,8-11,13-14H2,1H3 |
| InChIKey | KJRGJAHBVNZUSE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |