C14H18ClFN2O3 — CID 86788219
methyl 2-(2-chloro-6-fluorophenyl)-2-[methyl-[3-(methylamino)-3-oxopropyl]amino]acetate (PubChem CID 86788219) has the molecular formula C14H18ClFN2O3 and a molecular weight of 316.76 g/mol. Its IUPAC name is methyl 2-(2-chloro-6-fluorophenyl)-2-[methyl-[3-(methylamino)-3-oxopropyl]amino]acetate.
| Compound Name | methyl 2-(2-chloro-6-fluorophenyl)-2-[methyl-[3-(methylamino)-3-oxopropyl]amino]acetate |
|---|---|
| PubChem CID | 86788219 |
| Molecular Formula | C14H18ClFN2O3 |
| Molecular Weight | 316.76 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | methyl 2-(2-chloro-6-fluorophenyl)-2-[methyl-[3-(methylamino)-3-oxopropyl]amino]acetate |
| SMILES | CNC(=O)CCN(C)C(C(=O)OC)c1c(F)cccc1Cl |
| InChI | InChI=1S/C14H18ClFN2O3/c1-17-11(19)7-8-18(2)13(14(20)21-3)12-9(15)5-4-6-10(12)16/h4-6,13H,7-8H2,1-3H3,(H,17,19) |
| InChIKey | JFNJGKLNNZTYGD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.76 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |