C15H13F3N4O — CID 86791411
2,3,4-trifluoro-N-(4-pyrrolidin-1-ylpyrimidin-5-yl)benzamide (PubChem CID 86791411) has the molecular formula C15H13F3N4O and a molecular weight of 322.29 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-(4-pyrrolidin-1-ylpyrimidin-5-yl)benzamide.
| Compound Name | 2,3,4-trifluoro-N-(4-pyrrolidin-1-ylpyrimidin-5-yl)benzamide |
|---|---|
| PubChem CID | 86791411 |
| Molecular Formula | C15H13F3N4O |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 2,3,4-trifluoro-N-(4-pyrrolidin-1-ylpyrimidin-5-yl)benzamide |
| SMILES | O=C(Nc1cncnc1N1CCCC1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H13F3N4O/c16-10-4-3-9(12(17)13(10)18)15(23)21-11-7-19-8-20-14(11)22-5-1-2-6-22/h3-4,7-8H,1-2,5-6H2,(H,21,23) |
| InChIKey | GKVQHGVHPHRVMM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|