C16H24ClNO3S — CID 86794725
1-(4-chloro-2-methylphenyl)-N-[[4-(methylsulfonylmethyl)oxan-4-yl]methyl]methanamine (PubChem CID 86794725) has the molecular formula C16H24ClNO3S and a molecular weight of 345.89 g/mol. Its IUPAC name is 1-(4-chloro-2-methylphenyl)-N-[[4-(methylsulfonylmethyl)oxan-4-yl]methyl]methanamine.
| Compound Name | 1-(4-chloro-2-methylphenyl)-N-[[4-(methylsulfonylmethyl)oxan-4-yl]methyl]methanamine |
|---|---|
| PubChem CID | 86794725 |
| Molecular Formula | C16H24ClNO3S |
| Molecular Weight | 345.89 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 1-(4-chloro-2-methylphenyl)-N-[[4-(methylsulfonylmethyl)oxan-4-yl]methyl]methanamine |
| SMILES | Cc1cc(Cl)ccc1CNCC1(CS(C)(=O)=O)CCOCC1 |
| InChI | InChI=1S/C16H24ClNO3S/c1-13-9-15(17)4-3-14(13)10-18-11-16(12-22(2,19)20)5-7-21-8-6-16/h3-4,9,18H,5-8,10-12H2,1-2H3 |
| InChIKey | FKWORRGDOCHUHP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.89 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |