C14H15FN2O2 — CID 86801882
(Z)-N-(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-methylbut-2-enamide (PubChem CID 86801882) has the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. Its IUPAC name is (Z)-N-(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-methylbut-2-enamide.
| Compound Name | (Z)-N-(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-methylbut-2-enamide |
|---|---|
| PubChem CID | 86801882 |
| Molecular Formula | C14H15FN2O2 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (Z)-N-(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-methylbut-2-enamide |
| SMILES | C/C=C(/C)C(=O)Nc1cc2c(cc1F)NC(=O)CC2 |
| InChI | InChI=1S/C14H15FN2O2/c1-3-8(2)14(19)17-12-6-9-4-5-13(18)16-11(9)7-10(12)15/h3,6-7H,4-5H2,1-2H3,(H,16,18)(H,17,19)/b8-3- |
| InChIKey | BSBRUHBBVAQPDL-BAQGIRSFSA-N |
| XLogP | 2.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|