C21H20FN3O3 — CID 99606624
N-(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-[(2R,3R)-3-methyl-2-phenylazetidin-1-yl]-2-oxoacetamide (PubChem CID 99606624) has the molecular formula C21H20FN3O3 and a molecular weight of 381.41 g/mol. Its IUPAC name is N-(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-[(2R,3R)-3-methyl-2-phenylazetidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-[(2R,3R)-3-methyl-2-phenylazetidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 99606624 |
| Molecular Formula | C21H20FN3O3 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | N-(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-[(2R,3R)-3-methyl-2-phenylazetidin-1-yl]-2-oxoacetamide |
| SMILES | C[C@@H]1CN(C(=O)C(=O)Nc2cc3c(cc2F)NC(=O)CC3)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H20FN3O3/c1-12-11-25(19(12)13-5-3-2-4-6-13)21(28)20(27)24-17-9-14-7-8-18(26)23-16(14)10-15(17)22/h2-6,9-10,12,19H,7-8,11H2,1H3,(H,23,26)(H,24,27)/t12-,19-/m1/s1 |
| InChIKey | PVGSIXUEXWGOON-CWTRNNRKSA-N |
| XLogP | 2.87 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|