C13H13N5O3S — CID 86802771
6-methoxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylsulfanyl]-1H-benzimidazole (PubChem CID 86802771) has the molecular formula C13H13N5O3S and a molecular weight of 319.35 g/mol. Its IUPAC name is 6-methoxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylsulfanyl]-1H-benzimidazole.
| Compound Name | 6-methoxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylsulfanyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 86802771 |
| Molecular Formula | C13H13N5O3S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 6-methoxy-2-[(1-methyl-5-nitroimidazol-2-yl)methylsulfanyl]-1H-benzimidazole |
| SMILES | COc1ccc2nc(SCc3ncc([N+](=O)[O-])n3C)[nH]c2c1 |
| InChI | InChI=1S/C13H13N5O3S/c1-17-11(14-6-12(17)18(19)20)7-22-13-15-9-4-3-8(21-2)5-10(9)16-13/h3-6H,7H2,1-2H3,(H,15,16) |
| InChIKey | DAHKNGMTLSTPII-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 98.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|